![[ICO]](/icons/blank.gif){kind=icon} | Name | Last modified | Size | Description |
|---|---|---|---|---|
![[PARENTDIR]](/icons/back.gif){kind=icon} | Parent Directory | - | ||
![[TXT]](/icons/text.gif){kind=icon} | png.html | 1998-11-02 18:54 | 13K | |
| PNG-Introduction.html | 1998-11-02 18:54 | 4.5K | |
| PNG-DataRep.html | 1998-11-02 18:54 | 14K | |
| PNG-Structure.html | 1998-11-02 18:54 | 11K | |
| PNG-Chunks.html | 1998-11-02 18:54 | 44K | |
| PNG-Compression.html | 1998-11-02 18:54 | 5.2K | |
| PNG-Filters.html | 1998-11-02 18:54 | 13K | |
| PNG-Ordering.html | 1998-11-02 18:54 | 5.8K | |
| PNG-Misc.html | 1998-11-02 18:54 | 5.3K | |
| PNG-Encoders.html | 1998-11-02 18:54 | 30K | |
| PNG-Decoders.html | 1998-11-02 18:54 | 35K | |
| PNG-Glossary.html | 1998-11-02 18:54 | 8.5K | |
| PNG-Rationale.html | 1998-11-02 18:54 | 27K | |
| PNG-GammaAppendix.html | 1998-11-02 18:54 | 18K | |
| PNG-CRCAppendix.html | 1998-11-02 18:54 | 3.3K | |
| PNG-ColorAppendix.html | 1998-11-02 18:54 | 11K | |
| PNG-History.html | 1998-11-02 18:54 | 3.1K | |
| PNG-Resources.html | 1998-11-02 18:54 | 2.5K | |
| PNG-References.html | 1998-11-02 18:54 | 7.4K | |
| PNG-Credits.html | 1998-11-02 18:54 | 6.5K | |
|
Powered by:
|
 |
 |
Your donation powers our service to the FOSS community.
|
Some content may have been moved to our new secondary mirroring service.
OSUOSL © 2024